C26H20F4N2O — CID 143372248
fluoroform;1-[1-(3-fluorophenyl)indazol-5-yl]-1-naphthalen-1-ylethanol (PubChem CID 143372248) has the molecular formula C26H20F4N2O and a molecular weight of 452.45 g/mol. Its IUPAC name is fluoroform;1-[1-(3-fluorophenyl)indazol-5-yl]-1-naphthalen-1-ylethanol.
| Compound Name | fluoroform;1-[1-(3-fluorophenyl)indazol-5-yl]-1-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 143372248 |
| Molecular Formula | C26H20F4N2O |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | fluoroform;1-[1-(3-fluorophenyl)indazol-5-yl]-1-naphthalen-1-ylethanol |
| SMILES | CC(O)(c1ccc2c(cnn2-c2cccc(F)c2)c1)c1cccc2ccccc12.FC(F)F |
| InChI | InChI=1S/C25H19FN2O.CHF3/c1-25(29,23-11-4-7-17-6-2-3-10-22(17)23)19-12-13-24-18(14-19)16-27-28(24)21-9-5-8-20(26)15-21;2-1(3)4/h2-16,29H,1H3;1H |
| InChIKey | QPXCDGNJARKAAW-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |