C23H26FN3O2 — CID 164625585
1-(3-fluorophenyl)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]indazole-5-carboxamide (PubChem CID 164625585) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]indazole-5-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 164625585 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]indazole-5-carboxamide |
| SMILES | CC(C)(O)C1CCC(NC(=O)c2ccc3c(cnn3-c3cccc(F)c3)c2)CC1 |
| InChI | InChI=1S/C23H26FN3O2/c1-23(2,29)17-7-9-19(10-8-17)26-22(28)15-6-11-21-16(12-15)14-25-27(21)20-5-3-4-18(24)13-20/h3-6,11-14,17,19,29H,7-10H2,1-2H3,(H,26,28) |
| InChIKey | AWJZSXZTZBLZIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |