About cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol
cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol (PubChem CID 143372409) has the molecular formula C27H30N2O
and a molecular weight of 398.55 g/mol. Its IUPAC name is cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol |
| PubChem CID | 143372409 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol |
| SMILES | C1CCC1.Cc1cccc(CC(C)(O)c2ccc3c(cnn3-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H22N2O.C4H8/c1-17-7-6-8-18(13-17)15-23(2,26)20-11-12-22-19(14-20)16-24-25(22)21-9-4-3-5-10-21;1-2-4-3-1/h3-14,16,26H,15H2,1-2H3;1-4H2 |
| InChIKey | XNUIPDQURPPGJR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol?
The IUPAC name of cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol (CID 143372409) is cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol.
What is the SMILES notation for cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol?
The canonical SMILES for cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol is C1CCC1.Cc1cccc(CC(C)(O)c2ccc3c(cnn3-c3ccccc3)c2)c1.
What is the InChIKey of cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol?
The InChIKey is XNUIPDQURPPGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O.C4H8/c1-17-7-6-8-18(13-17)15-23(2,26)20-11-12-22-19(14-20)16-24-25(22)21-9-4-3-5-10-21;1-2-4-3-1/h3-14,16,26H,15H2,1-2H3;1-4H2.
What are the key properties of cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol?
cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol has a molecular weight of 398.55 g/mol, XLogP of 6.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;1-(3-methylphenyl)-2-(1-phenylindazol-5-yl)propan-2-ol is sourced from PubChem (CID 143372409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).