C23H21FN2O2S — CID 151959863
1-fluoro-3-(4-methoxyphenyl)sulfanyl-2-(1-phenylindazol-5-yl)propan-2-ol (PubChem CID 151959863) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-fluoro-3-(4-methoxyphenyl)sulfanyl-2-(1-phenylindazol-5-yl)propan-2-ol.
| Compound Name | 1-fluoro-3-(4-methoxyphenyl)sulfanyl-2-(1-phenylindazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 151959863 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-fluoro-3-(4-methoxyphenyl)sulfanyl-2-(1-phenylindazol-5-yl)propan-2-ol |
| SMILES | COc1ccc(SCC(O)(CF)c2ccc3c(cnn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H21FN2O2S/c1-28-20-8-10-21(11-9-20)29-16-23(27,15-24)18-7-12-22-17(13-18)14-25-26(22)19-5-3-2-4-6-19/h2-14,27H,15-16H2,1H3 |
| InChIKey | TYKOQNFCCOQRLA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |