C23H22F2N4O — CID 151196257
1-[N-(aminomethyl)anilino]-3-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-ol (PubChem CID 151196257) has the molecular formula C23H22F2N4O and a molecular weight of 408.45 g/mol. Its IUPAC name is 1-[N-(aminomethyl)anilino]-3-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-ol.
| Compound Name | 1-[N-(aminomethyl)anilino]-3-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 151196257 |
| Molecular Formula | C23H22F2N4O |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[N-(aminomethyl)anilino]-3-fluoro-2-[1-(4-fluorophenyl)indazol-5-yl]propan-2-ol |
| SMILES | NCN(CC(O)(CF)c1ccc2c(cnn2-c2ccc(F)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H22F2N4O/c24-14-23(30,15-28(16-26)20-4-2-1-3-5-20)18-6-11-22-17(12-18)13-27-29(22)21-9-7-19(25)8-10-21/h1-13,30H,14-16,26H2 |
| InChIKey | NHJFKCQMQLHBRT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|