C27H24N2O2 — CID 143371944
1-[1-(4-methoxyphenyl)indazol-5-yl]-2-naphthalen-1-ylpropan-2-ol (PubChem CID 143371944) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)indazol-5-yl]-2-naphthalen-1-ylpropan-2-ol.
| Compound Name | 1-[1-(4-methoxyphenyl)indazol-5-yl]-2-naphthalen-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 143371944 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)indazol-5-yl]-2-naphthalen-1-ylpropan-2-ol |
| SMILES | COc1ccc(-n2ncc3cc(CC(C)(O)c4cccc5ccccc45)ccc32)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-27(30,25-9-5-7-20-6-3-4-8-24(20)25)17-19-10-15-26-21(16-19)18-28-29(26)22-11-13-23(31-2)14-12-22/h3-16,18,30H,17H2,1-2H3 |
| InChIKey | OLMTZMLHZKCCBW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |