C16H12N4O2 — CID 3079200
2-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-3-one (PubChem CID 3079200) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-3-one.
| Compound Name | 2-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-3-one |
|---|---|
| PubChem CID | 3079200 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-3-one |
| SMILES | COc1ccc(-n2nc3c4ccccc4cnn3c2=O)cc1 |
| InChI | InChI=1S/C16H12N4O2/c1-22-13-8-6-12(7-9-13)19-16(21)20-15(18-19)14-5-3-2-4-11(14)10-17-20/h2-10H,1H3 |
| InChIKey | YSWIMZMBBZSYDI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |