C22H14F4N4O2 — CID 59437236
2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(7-hydroxypyrrolo[2,3-b]pyridin-3-yl)ethanol (PubChem CID 59437236) has the molecular formula C22H14F4N4O2 and a molecular weight of 442.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(7-hydroxypyrrolo[2,3-b]pyridin-3-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(7-hydroxypyrrolo[2,3-b]pyridin-3-yl)ethanol |
|---|---|
| PubChem CID | 59437236 |
| Molecular Formula | C22H14F4N4O2 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(7-hydroxypyrrolo[2,3-b]pyridin-3-yl)ethanol |
| SMILES | On1cccc2c(C(O)(c3ccc4c(cnn4-c4ccc(F)cc4)c3)C(F)(F)F)cnc1-2 |
| InChI | InChI=1S/C22H14F4N4O2/c23-15-4-6-16(7-5-15)30-19-8-3-14(10-13(19)11-28-30)21(31,22(24,25)26)18-12-27-20-17(18)2-1-9-29(20)32/h1-12,31-32H |
| InChIKey | LBGNOJBTRHVRCS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|