C23H29FN4O — CID 59251182
1-ethyl-3-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,3-trimethylbutyl]urea (PubChem CID 59251182) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,3-trimethylbutyl]urea.
| Compound Name | 1-ethyl-3-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,3-trimethylbutyl]urea |
|---|---|
| PubChem CID | 59251182 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-ethyl-3-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,3-trimethylbutyl]urea |
| SMILES | CCNC(=O)NCC(C)(C)C(C)(C)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H29FN4O/c1-6-25-21(29)26-15-22(2,3)23(4,5)17-7-12-20-16(13-17)14-27-28(20)19-10-8-18(24)9-11-19/h7-14H,6,15H2,1-5H3,(H2,25,26,29) |
| InChIKey | NCZHOXNSHKVDIO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |