C28H35FN4O — CID 87544376
1-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexyl]-3-(2-methylbut-3-yn-2-yl)urea (PubChem CID 87544376) has the molecular formula C28H35FN4O and a molecular weight of 462.61 g/mol. Its IUPAC name is 1-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexyl]-3-(2-methylbut-3-yn-2-yl)urea.
| Compound Name | 1-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexyl]-3-(2-methylbut-3-yn-2-yl)urea |
|---|---|
| PubChem CID | 87544376 |
| Molecular Formula | C28H35FN4O |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 1-[3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhexyl]-3-(2-methylbut-3-yn-2-yl)urea |
| SMILES | C#CC(C)(C)NC(=O)NCC(C)(C)C(CC(C)C)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H35FN4O/c1-8-28(6,7)32-26(34)30-18-27(4,5)24(15-19(2)3)20-9-14-25-21(16-20)17-31-33(25)23-12-10-22(29)11-13-23/h1,9-14,16-17,19,24H,15,18H2,2-7H3,(H2,30,32,34) |
| InChIKey | RPDHIESJCPWMIV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|