C23H25F4N3O2S — CID 89270416
2,2,2-trifluoro-N-[3-[1-(4-fluorophenyl)indazol-5-yl]-5-methyl-2-methylidenehexyl]ethanesulfonamide (PubChem CID 89270416) has the molecular formula C23H25F4N3O2S and a molecular weight of 483.53 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[1-(4-fluorophenyl)indazol-5-yl]-5-methyl-2-methylidenehexyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[1-(4-fluorophenyl)indazol-5-yl]-5-methyl-2-methylidenehexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 89270416 |
| Molecular Formula | C23H25F4N3O2S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[1-(4-fluorophenyl)indazol-5-yl]-5-methyl-2-methylidenehexyl]ethanesulfonamide |
| SMILES | C=C(CNS(=O)(=O)CC(F)(F)F)C(CC(C)C)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H25F4N3O2S/c1-15(2)10-21(16(3)12-29-33(31,32)14-23(25,26)27)17-4-9-22-18(11-17)13-28-30(22)20-7-5-19(24)6-8-20/h4-9,11,13,15,21,29H,3,10,12,14H2,1-2H3 |
| InChIKey | QYZLWFSXFCEFSK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|