C21H22F2N8O3 — CID 174236913
3-amino-1-[4-[(6-aminopurin-9-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-yl]-N-cyclopropylpyrrolidine-3-carboxamide (PubChem CID 174236913) has the molecular formula C21H22F2N8O3 and a molecular weight of 472.46 g/mol. Its IUPAC name is 3-amino-1-[4-[(6-aminopurin-9-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-yl]-N-cyclopropylpyrrolidine-3-carboxamide.
| Compound Name | 3-amino-1-[4-[(6-aminopurin-9-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-yl]-N-cyclopropylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 174236913 |
| Molecular Formula | C21H22F2N8O3 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-amino-1-[4-[(6-aminopurin-9-yl)methyl]-2,2-difluoro-1,3-benzodioxol-5-yl]-N-cyclopropylpyrrolidine-3-carboxamide |
| SMILES | Nc1ncnc2c1ncn2Cc1c(N2CCC(N)(C(=O)NC3CC3)C2)ccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C21H22F2N8O3/c22-21(23)33-14-4-3-13(30-6-5-20(25,8-30)19(32)29-11-1-2-11)12(16(14)34-21)7-31-10-28-15-17(24)26-9-27-18(15)31/h3-4,9-11H,1-2,5-8,25H2,(H,29,32)(H2,24,26,27) |
| InChIKey | JJEPWCIHZJKGRO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|