C27H27N3OS — CID 174237510
5-(azetidin-3-ylamino)-N-[1-[3-(1-benzothiophen-2-yl)phenyl]ethyl]-2-methylbenzamide (PubChem CID 174237510) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is 5-(azetidin-3-ylamino)-N-[1-[3-(1-benzothiophen-2-yl)phenyl]ethyl]-2-methylbenzamide.
| Compound Name | 5-(azetidin-3-ylamino)-N-[1-[3-(1-benzothiophen-2-yl)phenyl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 174237510 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-(azetidin-3-ylamino)-N-[1-[3-(1-benzothiophen-2-yl)phenyl]ethyl]-2-methylbenzamide |
| SMILES | Cc1ccc(NC2CNC2)cc1C(=O)NC(C)c1cccc(-c2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C27H27N3OS/c1-17-10-11-22(30-23-15-28-16-23)14-24(17)27(31)29-18(2)19-7-5-8-20(12-19)26-13-21-6-3-4-9-25(21)32-26/h3-14,18,23,28,30H,15-16H2,1-2H3,(H,29,31) |
| InChIKey | YLYMTVCDKMRMMN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |