C25H25N3O4S — CID 174234531
3-[3-[[(1R)-1-[3-(5-formylthiophen-2-yl)phenyl]ethyl]carbamoyl]-4-methylanilino]azetidine-1-carboxylic acid (PubChem CID 174234531) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-[3-[[(1R)-1-[3-(5-formylthiophen-2-yl)phenyl]ethyl]carbamoyl]-4-methylanilino]azetidine-1-carboxylic acid.
| Compound Name | 3-[3-[[(1R)-1-[3-(5-formylthiophen-2-yl)phenyl]ethyl]carbamoyl]-4-methylanilino]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174234531 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-[3-[[(1R)-1-[3-(5-formylthiophen-2-yl)phenyl]ethyl]carbamoyl]-4-methylanilino]azetidine-1-carboxylic acid |
| SMILES | Cc1ccc(NC2CN(C(=O)O)C2)cc1C(=O)N[C@H](C)c1cccc(-c2ccc(C=O)s2)c1 |
| InChI | InChI=1S/C25H25N3O4S/c1-15-6-7-19(27-20-12-28(13-20)25(31)32)11-22(15)24(30)26-16(2)17-4-3-5-18(10-17)23-9-8-21(14-29)33-23/h3-11,14,16,20,27H,12-13H2,1-2H3,(H,26,30)(H,31,32)/t16-/m1/s1 |
| InChIKey | MWTZVXFDLVVUHU-MRXNPFEDSA-N |
| XLogP | 4.80 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|