C32H44N2O2S — CID 178174423
5-acetamido-2-methyl-N-[1-[3-[5-(2-methylpropyl)thiophen-2-yl]phenyl]ethyl]benzamide;hexane (PubChem CID 178174423) has the molecular formula C32H44N2O2S and a molecular weight of 520.78 g/mol. Its IUPAC name is 5-acetamido-2-methyl-N-[1-[3-[5-(2-methylpropyl)thiophen-2-yl]phenyl]ethyl]benzamide;hexane.
| Compound Name | 5-acetamido-2-methyl-N-[1-[3-[5-(2-methylpropyl)thiophen-2-yl]phenyl]ethyl]benzamide;hexane |
|---|---|
| PubChem CID | 178174423 |
| Molecular Formula | C32H44N2O2S |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 5-acetamido-2-methyl-N-[1-[3-[5-(2-methylpropyl)thiophen-2-yl]phenyl]ethyl]benzamide;hexane |
| SMILES | CC(=O)Nc1ccc(C)c(C(=O)NC(C)c2cccc(-c3ccc(CC(C)C)s3)c2)c1.CCCCCC |
| InChI | InChI=1S/C26H30N2O2S.C6H14/c1-16(2)13-23-11-12-25(31-23)21-8-6-7-20(14-21)18(4)27-26(30)24-15-22(28-19(5)29)10-9-17(24)3;1-3-5-6-4-2/h6-12,14-16,18H,13H2,1-5H3,(H,27,30)(H,28,29);3-6H2,1-2H3 |
| InChIKey | QRCOVMUJMQQMNA-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|