C28H30N6O3S — CID 174239741
4-[2-[2-methyl-5-[(S)-phenyl-(sulfinoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine (PubChem CID 174239741) has the molecular formula C28H30N6O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is 4-[2-[2-methyl-5-[(S)-phenyl-(sulfinoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine.
| Compound Name | 4-[2-[2-methyl-5-[(S)-phenyl-(sulfinoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine |
|---|---|
| PubChem CID | 174239741 |
| Molecular Formula | C28H30N6O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 4-[2-[2-methyl-5-[(S)-phenyl-(sulfinoamino)methyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine |
| SMILES | Cc1ccc([C@@H](NS(=O)O)c2ccccc2)cc1Oc1ncccc1-c1ccnc(N[C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C28H30N6O3S/c1-19-11-12-21(26(34-38(35)36)20-7-3-2-4-8-20)17-25(19)37-27-23(10-6-15-30-27)24-13-16-31-28(33-24)32-22-9-5-14-29-18-22/h2-4,6-8,10-13,15-17,22,26,29,34H,5,9,14,18H2,1H3,(H,35,36)(H,31,32,33)/t22-,26-/m0/s1 |
| InChIKey | PIVPVTFNFCCGHQ-NVQXNPDNSA-N |
| XLogP | 4.62 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|