C26H31FN6O3S — CID 174239766
4-[2-[2-fluoro-6-methyl-4-[1-(sulfinoamino)cyclopentyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine (PubChem CID 174239766) has the molecular formula C26H31FN6O3S and a molecular weight of 526.64 g/mol. Its IUPAC name is 4-[2-[2-fluoro-6-methyl-4-[1-(sulfinoamino)cyclopentyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine.
| Compound Name | 4-[2-[2-fluoro-6-methyl-4-[1-(sulfinoamino)cyclopentyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine |
|---|---|
| PubChem CID | 174239766 |
| Molecular Formula | C26H31FN6O3S |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 4-[2-[2-fluoro-6-methyl-4-[1-(sulfinoamino)cyclopentyl]phenoxy]-3-pyridinyl]-2-[[(3S)-piperidin-3-yl]amino]pyrimidine |
| SMILES | Cc1cc(C2(NS(=O)O)CCCC2)cc(F)c1Oc1ncccc1-c1ccnc(N[C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C26H31FN6O3S/c1-17-14-18(26(33-37(34)35)9-2-3-10-26)15-21(27)23(17)36-24-20(7-5-12-29-24)22-8-13-30-25(32-22)31-19-6-4-11-28-16-19/h5,7-8,12-15,19,28,33H,2-4,6,9-11,16H2,1H3,(H,34,35)(H,30,31,32)/t19-/m0/s1 |
| InChIKey | GHYLNVXHVVUZKU-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|