C26H31ClF3N5O3 — CID 174241316
tert-butyl 2-[1-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoyl]cyclobutyl]pyrazol-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 174241316) has the molecular formula C26H31ClF3N5O3 and a molecular weight of 554.01 g/mol. Its IUPAC name is tert-butyl 2-[1-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoyl]cyclobutyl]pyrazol-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[1-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoyl]cyclobutyl]pyrazol-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 174241316 |
| Molecular Formula | C26H31ClF3N5O3 |
| Molecular Weight | 554.01 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | tert-butyl 2-[1-[1-[[2-chloro-4-(trifluoromethyl)phenyl]carbamoyl]cyclobutyl]pyrazol-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(c3cnn(C4(C(=O)Nc5ccc(C(F)(F)F)cc5Cl)CCC4)c3)CC2C1 |
| InChI | InChI=1S/C26H31ClF3N5O3/c1-24(2,3)38-23(37)34-13-16-11-33(12-17(16)14-34)19-10-31-35(15-19)25(7-4-8-25)22(36)32-21-6-5-18(9-20(21)27)26(28,29)30/h5-6,9-10,15-17H,4,7-8,11-14H2,1-3H3,(H,32,36) |
| InChIKey | HLBKJRVATMNJGM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.01 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |