C21H23ClF3N5O — CID 167459949
1-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]pyrazol-1-yl]-N-[2-chloro-4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide (PubChem CID 167459949) has the molecular formula C21H23ClF3N5O and a molecular weight of 453.90 g/mol. Its IUPAC name is 1-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]pyrazol-1-yl]-N-[2-chloro-4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide.
| Compound Name | 1-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]pyrazol-1-yl]-N-[2-chloro-4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167459949 |
| Molecular Formula | C21H23ClF3N5O |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 1-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]pyrazol-1-yl]-N-[2-chloro-4-(trifluoromethyl)phenyl]cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1Cl)C1(n2cc(N3C[C@H]4CNC[C@H]4C3)cn2)CCC1 |
| InChI | InChI=1S/C21H23ClF3N5O/c22-17-6-15(21(23,24)25)2-3-18(17)28-19(31)20(4-1-5-20)30-12-16(9-27-30)29-10-13-7-26-8-14(13)11-29/h2-3,6,9,12-14,26H,1,4-5,7-8,10-11H2,(H,28,31)/t13-,14+ |
| InChIKey | DBWDYPCXFXKGTO-OKILXGFUSA-N |
| XLogP | 3.73 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |