C15H14BN3O3 — CID 174242986
[4-[(2-carbamoyl-1H-pyrrolo[2,3-b]pyridin-5-yl)methyl]phenyl]boronic acid (PubChem CID 174242986) has the molecular formula C15H14BN3O3 and a molecular weight of 295.11 g/mol. Its IUPAC name is [4-[(2-carbamoyl-1H-pyrrolo[2,3-b]pyridin-5-yl)methyl]phenyl]boronic acid.
| Compound Name | [4-[(2-carbamoyl-1H-pyrrolo[2,3-b]pyridin-5-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174242986 |
| Molecular Formula | C15H14BN3O3 |
| Molecular Weight | 295.11 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [4-[(2-carbamoyl-1H-pyrrolo[2,3-b]pyridin-5-yl)methyl]phenyl]boronic acid |
| SMILES | NC(=O)c1cc2cc(Cc3ccc(B(O)O)cc3)cnc2[nH]1 |
| InChI | InChI=1S/C15H14BN3O3/c17-14(20)13-7-11-6-10(8-18-15(11)19-13)5-9-1-3-12(4-2-9)16(21)22/h1-4,6-8,21-22H,5H2,(H2,17,20)(H,18,19) |
| InChIKey | DHCKUFAJAYSXOS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.11 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|