C18H25ClO10 — CID 174244171
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1-chlorobut-3-enoxy)oxan-2-yl]methyl acetate (PubChem CID 174244171) has the molecular formula C18H25ClO10 and a molecular weight of 436.84 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1-chlorobut-3-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1-chlorobut-3-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174244171 |
| Molecular Formula | C18H25ClO10 |
| Molecular Weight | 436.84 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1-chlorobut-3-enoxy)oxan-2-yl]methyl acetate |
| SMILES | C=CCC(Cl)O[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H25ClO10/c1-6-7-14(19)29-18-17(27-12(5)23)16(26-11(4)22)15(25-10(3)21)13(28-18)8-24-9(2)20/h6,13-18H,1,7-8H2,2-5H3/t13-,14?,15+,16+,17-,18+/m1/s1 |
| InChIKey | WQTHUJWKEVLBQN-VRBIZGRRSA-N |
| XLogP | 1.23 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.84 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|