C30H42O19 — CID 67641245
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(1-hydroxybut-3-en-2-yloxy)-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 67641245) has the molecular formula C30H42O19 and a molecular weight of 706.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(1-hydroxybut-3-en-2-yloxy)-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(1-hydroxybut-3-en-2-yloxy)-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67641245 |
| Molecular Formula | C30H42O19 |
| Molecular Weight | 706.65 g/mol |
| Exact Mass | 706.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-(1-hydroxybut-3-en-2-yloxy)-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | C=CC(CO)O[C@@H]1O[C@H](COC(C)=O)[C@@H](O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H42O19/c1-9-20(10-31)46-29-27(44-18(7)37)26(43-17(6)36)24(22(47-29)12-40-14(3)33)49-30-28(45-19(8)38)25(42-16(5)35)23(41-15(4)34)21(48-30)11-39-13(2)32/h9,20-31H,1,10-12H2,2-8H3/t20?,21-,22-,23-,24-,25+,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | LAIJVTSAMNXWFP-WPBNFCGXSA-N |
| XLogP | -0.83 |
| TPSA | 241.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.65 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|