C26H26N4O — CID 174245165
N-[1-[4-[4-(3-imino-3-pyridin-2-ylprop-1-en-2-yl)-2-pyridinyl]phenyl]ethenyl]oxan-4-amine (PubChem CID 174245165) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[1-[4-[4-(3-imino-3-pyridin-2-ylprop-1-en-2-yl)-2-pyridinyl]phenyl]ethenyl]oxan-4-amine.
| Compound Name | N-[1-[4-[4-(3-imino-3-pyridin-2-ylprop-1-en-2-yl)-2-pyridinyl]phenyl]ethenyl]oxan-4-amine |
|---|---|
| PubChem CID | 174245165 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[1-[4-[4-(3-imino-3-pyridin-2-ylprop-1-en-2-yl)-2-pyridinyl]phenyl]ethenyl]oxan-4-amine |
| SMILES | [H]/N=C(/C(=C)c1ccnc(-c2ccc(C(=C)NC3CCOCC3)cc2)c1)c1ccccn1 |
| InChI | InChI=1S/C26H26N4O/c1-18(26(27)24-5-3-4-13-28-24)22-10-14-29-25(17-22)21-8-6-20(7-9-21)19(2)30-23-11-15-31-16-12-23/h3-10,13-14,17,23,27,30H,1-2,11-12,15-16H2/b27-26- |
| InChIKey | WETIQTJQEZDWTR-RQZHXJHFSA-N |
| XLogP | 4.96 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|