C27H34N4O2 — CID 142916838
N-cyclohexyl-4-[4-[1-[[(E)-2-methyl-5-(methylamino)-1-oxopent-2-en-3-yl]amino]ethenyl]-2-pyridinyl]benzamide (PubChem CID 142916838) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-[1-[[(E)-2-methyl-5-(methylamino)-1-oxopent-2-en-3-yl]amino]ethenyl]-2-pyridinyl]benzamide.
| Compound Name | N-cyclohexyl-4-[4-[1-[[(E)-2-methyl-5-(methylamino)-1-oxopent-2-en-3-yl]amino]ethenyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 142916838 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-cyclohexyl-4-[4-[1-[[(E)-2-methyl-5-(methylamino)-1-oxopent-2-en-3-yl]amino]ethenyl]-2-pyridinyl]benzamide |
| SMILES | C=C(N/C(CCNC)=C(\C)C=O)c1ccnc(-c2ccc(C(=O)NC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H34N4O2/c1-19(18-32)25(14-15-28-3)30-20(2)23-13-16-29-26(17-23)21-9-11-22(12-10-21)27(33)31-24-7-5-4-6-8-24/h9-13,16-18,24,28,30H,2,4-8,14-15H2,1,3H3,(H,31,33)/b25-19+ |
| InChIKey | OECTZNRRTAFBHM-NCELDCMTSA-N |
| XLogP | 4.45 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|