C19H20F2N2O — CID 143032281
N-cyclopentyl-4-[4-(1,1-difluoroethyl)-2-pyridinyl]benzamide (PubChem CID 143032281) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-(1,1-difluoroethyl)-2-pyridinyl]benzamide.
| Compound Name | N-cyclopentyl-4-[4-(1,1-difluoroethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 143032281 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-cyclopentyl-4-[4-(1,1-difluoroethyl)-2-pyridinyl]benzamide |
| SMILES | CC(F)(F)c1ccnc(-c2ccc(C(=O)NC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C19H20F2N2O/c1-19(20,21)15-10-11-22-17(12-15)13-6-8-14(9-7-13)18(24)23-16-4-2-3-5-16/h6-12,16H,2-5H2,1H3,(H,23,24) |
| InChIKey | WYHRWEQJJAIVNH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |