C19H13F3N2O2 — CID 59673564
N-(2-hydroxyphenyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59673564) has the molecular formula C19H13F3N2O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-(2-hydroxyphenyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59673564 |
| Molecular Formula | C19H13F3N2O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-(2-hydroxyphenyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccccc1O)c1ccc(-c2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C19H13F3N2O2/c20-19(21,22)14-9-10-23-16(11-14)12-5-7-13(8-6-12)18(26)24-15-3-1-2-4-17(15)25/h1-11,25H,(H,24,26) |
| InChIKey | NWMCVHCJRVWQME-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|