C22H18F3NO2 — CID 143032649
2-[2-(2-hydroxyethyl)phenyl]-1-[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]ethanone (PubChem CID 143032649) has the molecular formula C22H18F3NO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethyl)phenyl]-1-[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]ethanone.
| Compound Name | 2-[2-(2-hydroxyethyl)phenyl]-1-[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]ethanone |
|---|---|
| PubChem CID | 143032649 |
| Molecular Formula | C22H18F3NO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[2-(2-hydroxyethyl)phenyl]-1-[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1CCO)c1ccc(-c2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C22H18F3NO2/c23-22(24,25)19-9-11-26-20(14-19)16-5-7-17(8-6-16)21(28)13-18-4-2-1-3-15(18)10-12-27/h1-9,11,14,27H,10,12-13H2 |
| InChIKey | CWNUMFUUKIVUQU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |