C23H21F3N2O3 — CID 59673106
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59673106) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59673106 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(-c3cc(C(F)(F)F)ccn3)cc2)cc1OC |
| InChI | InChI=1S/C23H21F3N2O3/c1-30-20-8-3-15(13-21(20)31-2)9-11-28-22(29)17-6-4-16(5-7-17)19-14-18(10-12-27-19)23(24,25)26/h3-8,10,12-14H,9,11H2,1-2H3,(H,28,29) |
| InChIKey | PJLZKVQZZRMMFQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |