C23H27F3N2O — CID 59672796
N-(4-tert-butylcyclohexyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 59672796) has the molecular formula C23H27F3N2O and a molecular weight of 404.48 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59672796 |
| Molecular Formula | C23H27F3N2O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-4-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | CC(C)(C)C1CCC(NC(=O)c2ccc(-c3cc(C(F)(F)F)ccn3)cc2)CC1 |
| InChI | InChI=1S/C23H27F3N2O/c1-22(2,3)17-8-10-19(11-9-17)28-21(29)16-6-4-15(5-7-16)20-14-18(12-13-27-20)23(24,25)26/h4-7,12-14,17,19H,8-11H2,1-3H3,(H,28,29) |
| InChIKey | LNSBHSMJYRLBII-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |