C17H24O2S — CID 174245907
[(2Z,4Z)-2-(2-methoxypropylsulfanyl)hexa-2,4-dien-3-yl]oxymethylbenzene (PubChem CID 174245907) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is [(2Z,4Z)-2-(2-methoxypropylsulfanyl)hexa-2,4-dien-3-yl]oxymethylbenzene.
| Compound Name | [(2Z,4Z)-2-(2-methoxypropylsulfanyl)hexa-2,4-dien-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 174245907 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [(2Z,4Z)-2-(2-methoxypropylsulfanyl)hexa-2,4-dien-3-yl]oxymethylbenzene |
| SMILES | C/C=C\C(OCc1ccccc1)=C(/C)SCC(C)OC |
| InChI | InChI=1S/C17H24O2S/c1-5-9-17(15(3)20-13-14(2)18-4)19-12-16-10-7-6-8-11-16/h5-11,14H,12-13H2,1-4H3/b9-5-,17-15- |
| InChIKey | UOJJKVSHWQYIEC-MRKGOSGCSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|