C45H84NO10P — CID 174246959
4-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethylamino]butanoic acid (PubChem CID 174246959) has the molecular formula C45H84NO10P and a molecular weight of 830.14 g/mol. Its IUPAC name is 4-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethylamino]butanoic acid.
| Compound Name | 4-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethylamino]butanoic acid |
|---|---|
| PubChem CID | 174246959 |
| Molecular Formula | C45H84NO10P |
| Molecular Weight | 830.14 g/mol |
| Exact Mass | 829.58 |
| IUPAC Name | 4-[2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethylamino]butanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCNCCCC(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H84NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-44(49)53-40-42(41-55-57(51,52)54-39-38-46-37-33-34-43(47)48)56-45(50)36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,42,46H,3-16,21-41H2,1-2H3,(H,47,48)(H,51,52)/b19-17-,20-18-/t42-/m1/s1 |
| InChIKey | DHWYEHSCMOPATR-PLQHGIRQSA-N |
| XLogP | 12.10 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.14 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|