C27H35FN4 — CID 174247280
1-[4-[4-[[4-(3-fluoro-4-prop-1-en-2-ylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethenamine (PubChem CID 174247280) has the molecular formula C27H35FN4 and a molecular weight of 434.60 g/mol. Its IUPAC name is 1-[4-[4-[[4-(3-fluoro-4-prop-1-en-2-ylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethenamine.
| Compound Name | 1-[4-[4-[[4-(3-fluoro-4-prop-1-en-2-ylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethenamine |
|---|---|
| PubChem CID | 174247280 |
| Molecular Formula | C27H35FN4 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-[4-[4-[[4-(3-fluoro-4-prop-1-en-2-ylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethenamine |
| SMILES | C=C(N)c1ccc(N2CCC(CN3CCN(c4ccc(C(=C)C)c(F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H35FN4/c1-20(2)26-9-8-25(18-27(26)28)32-16-14-30(15-17-32)19-22-10-12-31(13-11-22)24-6-4-23(5-7-24)21(3)29/h4-9,18,22H,1,3,10-17,19,29H2,2H3 |
| InChIKey | QFRCKZKNGUACTF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|