About CID 174249879
CID 174249879 (PubChem CID 174249879) has the molecular formula C18H16BCuP+2
and a molecular weight of 337.66 g/mol.
Molecular Properties
| Compound Name | CID 174249879 |
| PubChem CID | 174249879 |
| Molecular Formula | C18H16BCuP+2 |
| Molecular Weight | 337.66 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | — |
| SMILES | [B][P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cu].[H+] |
| InChI | InChI=1S/C18H15BP.Cu/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;/q+1;/p+1 |
| InChIKey | BBBQOAWKXUKFFL-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 174249879 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174249879?
The IUPAC name of CID 174249879 (CID 174249879) is not available.
What is the SMILES notation for CID 174249879?
The canonical SMILES for CID 174249879 is [B][P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cu].[H+].
What is the InChIKey of CID 174249879?
The InChIKey is BBBQOAWKXUKFFL-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15BP.Cu/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;/q+1;/p+1.
What are the key properties of CID 174249879?
CID 174249879 has a molecular weight of 337.66 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174249879 is sourced from PubChem (CID 174249879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).