C18H15FIN3O2 — CID 174253642
N-(3-carbamoyl-4-fluorophenyl)-1-ethyl-2-iodoindole-7-carboxamide (PubChem CID 174253642) has the molecular formula C18H15FIN3O2 and a molecular weight of 451.24 g/mol. Its IUPAC name is N-(3-carbamoyl-4-fluorophenyl)-1-ethyl-2-iodoindole-7-carboxamide.
| Compound Name | N-(3-carbamoyl-4-fluorophenyl)-1-ethyl-2-iodoindole-7-carboxamide |
|---|---|
| PubChem CID | 174253642 |
| Molecular Formula | C18H15FIN3O2 |
| Molecular Weight | 451.24 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | N-(3-carbamoyl-4-fluorophenyl)-1-ethyl-2-iodoindole-7-carboxamide |
| SMILES | CCn1c(I)cc2cccc(C(=O)Nc3ccc(F)c(C(N)=O)c3)c21 |
| InChI | InChI=1S/C18H15FIN3O2/c1-2-23-15(20)8-10-4-3-5-12(16(10)23)18(25)22-11-6-7-14(19)13(9-11)17(21)24/h3-9H,2H2,1H3,(H2,21,24)(H,22,25) |
| InChIKey | ZTTFHNMDUAEKSG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|