C23H38FN3 — CID 174258455
2-[2-[2-[4-(1-fluoropropyl)piperidin-1-yl]propyl]pyrrolidin-1-yl]-5-propan-2-ylpyridine (PubChem CID 174258455) has the molecular formula C23H38FN3 and a molecular weight of 375.58 g/mol. Its IUPAC name is 2-[2-[2-[4-(1-fluoropropyl)piperidin-1-yl]propyl]pyrrolidin-1-yl]-5-propan-2-ylpyridine.
| Compound Name | 2-[2-[2-[4-(1-fluoropropyl)piperidin-1-yl]propyl]pyrrolidin-1-yl]-5-propan-2-ylpyridine |
|---|---|
| PubChem CID | 174258455 |
| Molecular Formula | C23H38FN3 |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 2-[2-[2-[4-(1-fluoropropyl)piperidin-1-yl]propyl]pyrrolidin-1-yl]-5-propan-2-ylpyridine |
| SMILES | CCC(F)C1CCN(C(C)CC2CCCN2c2ccc(C(C)C)cn2)CC1 |
| InChI | InChI=1S/C23H38FN3/c1-5-22(24)19-10-13-26(14-11-19)18(4)15-21-7-6-12-27(21)23-9-8-20(16-25-23)17(2)3/h8-9,16-19,21-22H,5-7,10-15H2,1-4H3 |
| InChIKey | UEJCMUQDTROMAF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |