C26H28FN3O2 — CID 174259409
N-[4-[3-[3-[(2S)-2-ethylpiperazin-1-yl]phenyl]-2-hydroxyphenyl]-2-fluorophenyl]acetamide (PubChem CID 174259409) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[4-[3-[3-[(2S)-2-ethylpiperazin-1-yl]phenyl]-2-hydroxyphenyl]-2-fluorophenyl]acetamide.
| Compound Name | N-[4-[3-[3-[(2S)-2-ethylpiperazin-1-yl]phenyl]-2-hydroxyphenyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 174259409 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[4-[3-[3-[(2S)-2-ethylpiperazin-1-yl]phenyl]-2-hydroxyphenyl]-2-fluorophenyl]acetamide |
| SMILES | CC[C@H]1CNCCN1c1cccc(-c2cccc(-c3ccc(NC(C)=O)c(F)c3)c2O)c1 |
| InChI | InChI=1S/C26H28FN3O2/c1-3-20-16-28-12-13-30(20)21-7-4-6-18(14-21)22-8-5-9-23(26(22)32)19-10-11-25(24(27)15-19)29-17(2)31/h4-11,14-15,20,28,32H,3,12-13,16H2,1-2H3,(H,29,31)/t20-/m0/s1 |
| InChIKey | GIFVLDVJWCPKJP-FQEVSTJZSA-N |
| XLogP | 5.01 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |