C23H22F2N4O2 — CID 166167141
N-[2-fluoro-4-[3-(2-fluoro-6-piperazin-1-yl-4-pyridinyl)-2-hydroxyphenyl]phenyl]acetamide (PubChem CID 166167141) has the molecular formula C23H22F2N4O2 and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[2-fluoro-4-[3-(2-fluoro-6-piperazin-1-yl-4-pyridinyl)-2-hydroxyphenyl]phenyl]acetamide.
| Compound Name | N-[2-fluoro-4-[3-(2-fluoro-6-piperazin-1-yl-4-pyridinyl)-2-hydroxyphenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 166167141 |
| Molecular Formula | C23H22F2N4O2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[2-fluoro-4-[3-(2-fluoro-6-piperazin-1-yl-4-pyridinyl)-2-hydroxyphenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cccc(-c3cc(F)nc(N4CCNCC4)c3)c2O)cc1F |
| InChI | InChI=1S/C23H22F2N4O2/c1-14(30)27-20-6-5-15(11-19(20)24)17-3-2-4-18(23(17)31)16-12-21(25)28-22(13-16)29-9-7-26-8-10-29/h2-6,11-13,26,31H,7-10H2,1H3,(H,27,30) |
| InChIKey | ZZHDFEDWZCQTSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|