C13H16BrN3O — CID 174261434
1-[4-(aminomethyl)phenyl]-2-(3-methylimidazol-3-ium-1-yl)ethanone bromide (PubChem CID 174261434) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-2-(3-methylimidazol-3-ium-1-yl)ethanone bromide.
| Compound Name | 1-[4-(aminomethyl)phenyl]-2-(3-methylimidazol-3-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 174261434 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-2-(3-methylimidazol-3-ium-1-yl)ethanone bromide |
| SMILES | C[n+]1ccn(CC(=O)c2ccc(CN)cc2)c1.[Br-] |
| InChI | InChI=1S/C13H16N3O.BrH/c1-15-6-7-16(10-15)9-13(17)12-4-2-11(8-14)3-5-12;/h2-7,10H,8-9,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | QFAMZWWLHCSFMN-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|