C19H24NO2+ — CID 174262060
[(3R)-2,2-diphenyloxolan-3-yl]methyl-hydroxy-dimethylazanium (PubChem CID 174262060) has the molecular formula C19H24NO2+ and a molecular weight of 298.41 g/mol. Its IUPAC name is [(3R)-2,2-diphenyloxolan-3-yl]methyl-hydroxy-dimethylazanium.
| Compound Name | [(3R)-2,2-diphenyloxolan-3-yl]methyl-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 174262060 |
| Molecular Formula | C19H24NO2+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(3R)-2,2-diphenyloxolan-3-yl]methyl-hydroxy-dimethylazanium |
| SMILES | C[N+](C)(O)C[C@H]1CCOC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24NO2/c1-20(2,21)15-18-13-14-22-19(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18,21H,13-15H2,1-2H3/q+1/t18-/m1/s1 |
| InChIKey | KNSGIAAMKUVJFJ-GOSISDBHSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|