C14H19IO — CID 53242306
(2R,3R)-2-tert-butyl-3-iodo-2-phenyloxolane (PubChem CID 53242306) has the molecular formula C14H19IO and a molecular weight of 330.21 g/mol. Its IUPAC name is (2R,3R)-2-tert-butyl-3-iodo-2-phenyloxolane.
| Compound Name | (2R,3R)-2-tert-butyl-3-iodo-2-phenyloxolane |
|---|---|
| PubChem CID | 53242306 |
| Molecular Formula | C14H19IO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (2R,3R)-2-tert-butyl-3-iodo-2-phenyloxolane |
| SMILES | CC(C)(C)[C@]1(c2ccccc2)OCC[C@H]1I |
| InChI | InChI=1S/C14H19IO/c1-13(2,3)14(12(15)9-10-16-14)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | WJGJPSDOAHVRRP-TZMCWYRMSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|