C20H20F2O4 — CID 102315051
(2S,3R)-3-fluoro-2-[(2R,3S)-3-fluoro-2-phenyloxolan-2-yl]peroxy-2-phenyloxolane (PubChem CID 102315051) has the molecular formula C20H20F2O4 and a molecular weight of 362.37 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-2-[(2R,3S)-3-fluoro-2-phenyloxolan-2-yl]peroxy-2-phenyloxolane.
| Compound Name | (2S,3R)-3-fluoro-2-[(2R,3S)-3-fluoro-2-phenyloxolan-2-yl]peroxy-2-phenyloxolane |
|---|---|
| PubChem CID | 102315051 |
| Molecular Formula | C20H20F2O4 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S,3R)-3-fluoro-2-[(2R,3S)-3-fluoro-2-phenyloxolan-2-yl]peroxy-2-phenyloxolane |
| SMILES | F[C@@H]1CCO[C@]1(OO[C@@]1(c2ccccc2)OCC[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C20H20F2O4/c21-17-11-13-23-19(17,15-7-3-1-4-8-15)25-26-20(18(22)12-14-24-20)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18+,19+,20- |
| InChIKey | MDNPGWPWBCONQT-JVSBHGNQSA-N |
| XLogP | 4.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|