C15H19O+ — CID 102368152
1-phenyl-10-oxoniatricyclo[5.2.1.04,10]decane (PubChem CID 102368152) has the molecular formula C15H19O+ and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-phenyl-10-oxoniatricyclo[5.2.1.04,10]decane.
| Compound Name | 1-phenyl-10-oxoniatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 102368152 |
| Molecular Formula | C15H19O+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-phenyl-10-oxoniatricyclo[5.2.1.04,10]decane |
| SMILES | c1ccc(C23CCC4CCC(CC2)[O+]43)cc1 |
| InChI | InChI=1S/C15H19O/c1-2-4-12(5-3-1)15-10-8-13-6-7-14(9-11-15)16(13)15/h1-5,13-14H,6-11H2/q+1 |
| InChIKey | QYFUIUYPRFSLBY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|