C11H23N3O3 — CID 174262407
N-[(2R)-1-[[(2S)-4-amino-1-oxobutan-2-yl]amino]-1-hydroxy-4-methylpentan-2-yl]formamide (PubChem CID 174262407) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-[(2R)-1-[[(2S)-4-amino-1-oxobutan-2-yl]amino]-1-hydroxy-4-methylpentan-2-yl]formamide.
| Compound Name | N-[(2R)-1-[[(2S)-4-amino-1-oxobutan-2-yl]amino]-1-hydroxy-4-methylpentan-2-yl]formamide |
|---|---|
| PubChem CID | 174262407 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | N-[(2R)-1-[[(2S)-4-amino-1-oxobutan-2-yl]amino]-1-hydroxy-4-methylpentan-2-yl]formamide |
| SMILES | CC(C)C[C@@H](NC=O)C(O)N[C@H](C=O)CCN |
| InChI | InChI=1S/C11H23N3O3/c1-8(2)5-10(13-7-16)11(17)14-9(6-15)3-4-12/h6-11,14,17H,3-5,12H2,1-2H3,(H,13,16)/t9-,10+,11?/m0/s1 |
| InChIKey | OCZLDZCPTPIDEY-MTULOOOASA-N |
| XLogP | -1.03 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|