C54H36N6S2 — CID 174265256
2,4-diphenyl-6-[5-[3-[3-(4-phenyl-6-thianthren-1-yl-1,3,5-triazin-2-yl)phenyl]phenyl]cyclohexa-1,3-dien-1-yl]-1,3,5-triazine (PubChem CID 174265256) has the molecular formula C54H36N6S2 and a molecular weight of 833.06 g/mol. Its IUPAC name is 2,4-diphenyl-6-[5-[3-[3-(4-phenyl-6-thianthren-1-yl-1,3,5-triazin-2-yl)phenyl]phenyl]cyclohexa-1,3-dien-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[5-[3-[3-(4-phenyl-6-thianthren-1-yl-1,3,5-triazin-2-yl)phenyl]phenyl]cyclohexa-1,3-dien-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 174265256 |
| Molecular Formula | C54H36N6S2 |
| Molecular Weight | 833.06 g/mol |
| Exact Mass | 832.24 |
| IUPAC Name | 2,4-diphenyl-6-[5-[3-[3-(4-phenyl-6-thianthren-1-yl-1,3,5-triazin-2-yl)phenyl]phenyl]cyclohexa-1,3-dien-1-yl]-1,3,5-triazine |
| SMILES | C1=CC(c2cccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5Sc5ccccc5S6)n4)c3)c2)CC(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)=C1 |
| InChI | InChI=1S/C54H36N6S2/c1-4-16-35(17-5-1)49-55-50(36-18-6-2-7-19-36)57-52(56-49)42-26-13-24-40(33-42)38-22-12-23-39(32-38)41-25-14-27-43(34-41)53-58-51(37-20-8-3-9-21-37)59-54(60-53)44-28-15-31-47-48(44)62-46-30-11-10-29-45(46)61-47/h1-32,34,40H,33H2 |
| InChIKey | SAAONNQBAKWDLE-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.06 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |