C21H26N2 — CID 174266299
2-[(1-cyclopropylethenylamino)-(4-propan-2-ylphenyl)methyl]aniline (PubChem CID 174266299) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[(1-cyclopropylethenylamino)-(4-propan-2-ylphenyl)methyl]aniline.
| Compound Name | 2-[(1-cyclopropylethenylamino)-(4-propan-2-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 174266299 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-[(1-cyclopropylethenylamino)-(4-propan-2-ylphenyl)methyl]aniline |
| SMILES | C=C(NC(c1ccc(C(C)C)cc1)c1ccccc1N)C1CC1 |
| InChI | InChI=1S/C21H26N2/c1-14(2)16-8-12-18(13-9-16)21(23-15(3)17-10-11-17)19-6-4-5-7-20(19)22/h4-9,12-14,17,21,23H,3,10-11,22H2,1-2H3 |
| InChIKey | YJXMTGYCYUAXPZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|