C21H28N4 — CID 165139370
[4-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]phenyl]methanediamine (PubChem CID 165139370) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is [4-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]phenyl]methanediamine.
| Compound Name | [4-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]phenyl]methanediamine |
|---|---|
| PubChem CID | 165139370 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [4-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]phenyl]methanediamine |
| SMILES | C=C(N[C@@H](c1ccccc1)c1ccc(C(N)N)cc1)C1CCCN1C |
| InChI | InChI=1S/C21H28N4/c1-15(19-9-6-14-25(19)2)24-20(16-7-4-3-5-8-16)17-10-12-18(13-11-17)21(22)23/h3-5,7-8,10-13,19-21,24H,1,6,9,14,22-23H2,2H3/t19?,20-/m0/s1 |
| InChIKey | RALLBTBKQXEYJI-ANYOKISRSA-N |
| XLogP | 2.89 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|