C26H37F3N8 — CID 171097602
(1Z)-2-hydrazinylpenta-1,4-dien-1-amine;[6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-4-(trifluoromethyl)-3-pyridinyl]methanediamine (PubChem CID 171097602) has the molecular formula C26H37F3N8 and a molecular weight of 518.63 g/mol. Its IUPAC name is (1Z)-2-hydrazinylpenta-1,4-dien-1-amine;[6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-4-(trifluoromethyl)-3-pyridinyl]methanediamine.
| Compound Name | (1Z)-2-hydrazinylpenta-1,4-dien-1-amine;[6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-4-(trifluoromethyl)-3-pyridinyl]methanediamine |
|---|---|
| PubChem CID | 171097602 |
| Molecular Formula | C26H37F3N8 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | (1Z)-2-hydrazinylpenta-1,4-dien-1-amine;[6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-4-(trifluoromethyl)-3-pyridinyl]methanediamine |
| SMILES | C=C(NC(c1ccccc1)c1cc(C(F)(F)F)c(C(N)N)cn1)C1CCCN1C.C=CC/C(=C/N)NN |
| InChI | InChI=1S/C21H26F3N5.C5H11N3/c1-13(18-9-6-10-29(18)2)28-19(14-7-4-3-5-8-14)17-11-16(21(22,23)24)15(12-27-17)20(25)26;1-2-3-5(4-6)8-7/h3-5,7-8,11-12,18-20,28H,1,6,9-10,25-26H2,2H3;2,4,8H,1,3,6-7H2/b;5-4- |
| InChIKey | PFXRWRWCXAPVIZ-GUHKXDMSSA-N |
| XLogP | 3.13 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|