C30H38FN7 — CID 165138389
N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;(2-fluoro-3-pyridinyl)methanediamine;1-prop-2-enylbenzimidazole (PubChem CID 165138389) has the molecular formula C30H38FN7 and a molecular weight of 515.68 g/mol. Its IUPAC name is N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;(2-fluoro-3-pyridinyl)methanediamine;1-prop-2-enylbenzimidazole.
| Compound Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;(2-fluoro-3-pyridinyl)methanediamine;1-prop-2-enylbenzimidazole |
|---|---|
| PubChem CID | 165138389 |
| Molecular Formula | C30H38FN7 |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;(2-fluoro-3-pyridinyl)methanediamine;1-prop-2-enylbenzimidazole |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C.C=CCn1cnc2ccccc21.NC(N)c1cccnc1F |
| InChI | InChI=1S/C14H20N2.C10H10N2.C6H8FN3/c1-12(14-9-6-10-16(14)2)15-11-13-7-4-3-5-8-13;1-2-7-12-8-11-9-5-3-4-6-10(9)12;7-5-4(6(8)9)2-1-3-10-5/h3-5,7-8,14-15H,1,6,9-11H2,2H3;2-6,8H,1,7H2;1-3,6H,8-9H2 |
| InChIKey | ZITGUAKRPQNTFH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|