C20H26FN5 — CID 165139008
[2-fluoro-6-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-pyridinyl]methanediamine (PubChem CID 165139008) has the molecular formula C20H26FN5 and a molecular weight of 355.46 g/mol. Its IUPAC name is [2-fluoro-6-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-pyridinyl]methanediamine.
| Compound Name | [2-fluoro-6-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-pyridinyl]methanediamine |
|---|---|
| PubChem CID | 165139008 |
| Molecular Formula | C20H26FN5 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | [2-fluoro-6-[(S)-[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-pyridinyl]methanediamine |
| SMILES | C=C(N[C@@H](c1ccccc1)c1ccc(C(N)N)c(F)n1)C1CCCN1C |
| InChI | InChI=1S/C20H26FN5/c1-13(17-9-6-12-26(17)2)24-18(14-7-4-3-5-8-14)16-11-10-15(20(22)23)19(21)25-16/h3-5,7-8,10-11,17-18,20,24H,1,6,9,12,22-23H2,2H3/t17?,18-/m0/s1 |
| InChIKey | UNBHUORBWMZMFP-ZVAWYAOSSA-N |
| XLogP | 2.42 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|