C29H40F2N6 — CID 171097257
1,1-difluorohept-6-ene-2,4-diimine;6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-propan-2-ylpyridin-2-amine (PubChem CID 171097257) has the molecular formula C29H40F2N6 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1,1-difluorohept-6-ene-2,4-diimine;6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-propan-2-ylpyridin-2-amine.
| Compound Name | 1,1-difluorohept-6-ene-2,4-diimine;6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 171097257 |
| Molecular Formula | C29H40F2N6 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | 1,1-difluorohept-6-ene-2,4-diimine;6-[[1-(1-methylpyrrolidin-2-yl)ethenylamino]-phenylmethyl]-3-propan-2-ylpyridin-2-amine |
| SMILES | C=C(NC(c1ccccc1)c1ccc(C(C)C)c(N)n1)C1CCCN1C.[H]/N=C(/C/C(CC=C)=N/[H])C(F)F |
| InChI | InChI=1S/C22H30N4.C7H10F2N2/c1-15(2)18-12-13-19(25-22(18)23)21(17-9-6-5-7-10-17)24-16(3)20-11-8-14-26(20)4;1-2-3-5(10)4-6(11)7(8)9/h5-7,9-10,12-13,15,20-21,24H,3,8,11,14H2,1-2,4H3,(H2,23,25);2,7,10-11H,1,3-4H2/b;10-5+,11-6- |
| InChIKey | ZTAUNECWHNEXHY-GREYZWQUSA-N |
| XLogP | 6.33 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|